C31H35ClN2O9 — CID 10145663
2-[2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]ethyl]furan-3-carboxylic acid (PubChem CID 10145663) has the molecular formula C31H35ClN2O9 and a molecular weight of 615.08 g/mol. Its IUPAC name is 2-[2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]ethyl]furan-3-carboxylic acid.
| Compound Name | 2-[2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]ethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 10145663 |
| Molecular Formula | C31H35ClN2O9 |
| Molecular Weight | 615.08 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 2-[2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]ethyl]furan-3-carboxylic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)NCCc3occc3C(=O)O)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C31H35ClN2O9/c1-31(2,17-35)16-34-22-9-8-18(32)14-21(22)27(20-6-5-7-24(40-3)28(20)41-4)43-25(29(34)37)15-26(36)33-12-10-23-19(30(38)39)11-13-42-23/h5-9,11,13-14,25,27,35H,10,12,15-17H2,1-4H3,(H,33,36)(H,38,39)/t25-,27-/m1/s1 |
| InChIKey | OIRXCUHDCIGLQB-XNMGPUDCSA-N |
| XLogP | 4.24 |
| TPSA | 147.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.08 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |