C32H35AcClN2O8 — CID 59060632
actinium;2-[4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]phenyl]acetic acid (PubChem CID 59060632) has the molecular formula C32H35AcClN2O8 and a molecular weight of 838.09 g/mol. Its IUPAC name is actinium;2-[4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]phenyl]acetic acid.
| Compound Name | actinium;2-[4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 59060632 |
| Molecular Formula | C32H35AcClN2O8 |
| Molecular Weight | 838.09 g/mol |
| Exact Mass | 837.24 |
| IUPAC Name | actinium;2-[4-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]phenyl]acetic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)Nc3ccc(CC(=O)O)cc3)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC.[Ac] |
| InChI | InChI=1S/C32H35ClN2O8.Ac/c1-32(2,18-36)17-35-24-13-10-20(33)15-23(24)29(22-6-5-7-25(41-3)30(22)42-4)43-26(31(35)40)16-27(37)34-21-11-8-19(9-12-21)14-28(38)39;/h5-13,15,26,29,36H,14,16-18H2,1-4H3,(H,34,37)(H,38,39);/t26-,29-;/m1./s1 |
| InChIKey | OMRYVEGAONJJIQ-OVWBULDYSA-N |
| XLogP | 4.85 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.09 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |