C21H23NO2 — CID 101457570
(4R,6R)-2,6-dibenzyl-4-methoxyoxane-2-carbonitrile (PubChem CID 101457570) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (4R,6R)-2,6-dibenzyl-4-methoxyoxane-2-carbonitrile.
| Compound Name | (4R,6R)-2,6-dibenzyl-4-methoxyoxane-2-carbonitrile |
|---|---|
| PubChem CID | 101457570 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (4R,6R)-2,6-dibenzyl-4-methoxyoxane-2-carbonitrile |
| SMILES | CO[C@@H]1C[C@@H](Cc2ccccc2)OC(C#N)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO2/c1-23-20-13-19(12-17-8-4-2-5-9-17)24-21(15-20,16-22)14-18-10-6-3-7-11-18/h2-11,19-20H,12-15H2,1H3/t19-,20-,21?/m1/s1 |
| InChIKey | AOPOXRLXSFGCAJ-OSBQEZSISA-N |
| XLogP | 3.93 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |