C19H30O6 — CID 101457591
(1S,5R,7E,9R,10R,11R,12R,13S)-5-ethenyl-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one (PubChem CID 101457591) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (1S,5R,7E,9R,10R,11R,12R,13S)-5-ethenyl-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one.
| Compound Name | (1S,5R,7E,9R,10R,11R,12R,13S)-5-ethenyl-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one |
|---|---|
| PubChem CID | 101457591 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1S,5R,7E,9R,10R,11R,12R,13S)-5-ethenyl-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one |
| SMILES | C=C[C@H]1C/C(C)=C/[C@@H](OC)[C@@H](C)[C@@H]2O[C@](O)(CC(=O)O1)C[C@H](O)[C@H]2C |
| InChI | InChI=1S/C19H30O6/c1-6-14-7-11(2)8-16(23-5)13(4)18-12(3)15(20)9-19(22,25-18)10-17(21)24-14/h6,8,12-16,18,20,22H,1,7,9-10H2,2-5H3/b11-8+/t12-,13-,14+,15+,16-,18-,19+/m1/s1 |
| InChIKey | ZDSXMMYRGNQFFL-IMFPKCRJSA-N |
| XLogP | 1.95 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|