About ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate
ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate (PubChem CID 101457773) has the molecular formula C16H16Cl2N2O2
and a molecular weight of 339.22 g/mol. Its IUPAC name is ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate |
| PubChem CID | 101457773 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate |
| SMILES | CCCCc1cc2c(C(=O)OCC)c(C#N)c(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-3-5-6-9-7-10-12(16(21)22-4-2)11(8-19)13(17)14(18)15(10)20-9/h7,20H,3-6H2,1-2H3 |
| InChIKey | WMGBDABZLIWFNO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate?
The IUPAC name of ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate (CID 101457773) is ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate.
What is the SMILES notation for ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate?
The canonical SMILES for ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate is CCCCc1cc2c(C(=O)OCC)c(C#N)c(Cl)c(Cl)c2[nH]1.
What is the InChIKey of ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate?
The InChIKey is WMGBDABZLIWFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N2O2/c1-3-5-6-9-7-10-12(16(21)22-4-2)11(8-19)13(17)14(18)15(10)20-9/h7,20H,3-6H2,1-2H3.
What are the key properties of ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate?
ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate has a molecular weight of 339.22 g/mol, XLogP of 4.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-butyl-6,7-dichloro-5-cyano-1H-indole-4-carboxylate is sourced from PubChem (CID 101457773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).