C31H31N2O10S- — CID 10145847
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[2-[hydroxy(oxido)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylsulfanylpropanoic acid (PubChem CID 10145847) has the molecular formula C31H31N2O10S- and a molecular weight of 623.66 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[2-[hydroxy(oxido)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylsulfanylpropanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[2-[hydroxy(oxido)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 10145847 |
| Molecular Formula | C31H31N2O10S- |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[2-[hydroxy(oxido)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylsulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)C(OC(=O)SC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)c1ccccc1N([O-])O |
| InChI | InChI=1S/C31H31N2O10S/c1-31(2,3)43-28(36)26(22-14-8-9-15-25(22)33(39)40)42-30(38)44-17-24(27(34)35)32-29(37)41-16-23-20-12-6-4-10-18(20)19-11-5-7-13-21(19)23/h4-15,23-24,26,39H,16-17H2,1-3H3,(H,32,37)(H,34,35)/q-1/t24-,26?/m1/s1 |
| InChIKey | YLZRLBIKZRWTCK-RMVMEJTISA-N |
| XLogP | 5.62 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|