C14H14N2OS2 — CID 101460138
10-oxa-7,13-dithia-18,19-diazatricyclo[12.3.1.12,6]nonadeca-1(18),2(19),3,5,14,16-hexaene (PubChem CID 101460138) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 10-oxa-7,13-dithia-18,19-diazatricyclo[12.3.1.12,6]nonadeca-1(18),2(19),3,5,14,16-hexaene.
| Compound Name | 10-oxa-7,13-dithia-18,19-diazatricyclo[12.3.1.12,6]nonadeca-1(18),2(19),3,5,14,16-hexaene |
|---|---|
| PubChem CID | 101460138 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 10-oxa-7,13-dithia-18,19-diazatricyclo[12.3.1.12,6]nonadeca-1(18),2(19),3,5,14,16-hexaene |
| SMILES | c1cc2nc(c1)-c1cccc(n1)SCCOCCS2 |
| InChI | InChI=1S/C14H14N2OS2/c1-3-11-12-4-2-6-14(16-12)19-10-8-17-7-9-18-13(5-1)15-11/h1-6H,7-10H2 |
| InChIKey | GPBHQHIJJLGZOL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |