C36H39NO3 — CID 101460975
[4-[4-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phenyl] 4-octoxybenzoate (PubChem CID 101460975) has the molecular formula C36H39NO3 and a molecular weight of 533.71 g/mol. Its IUPAC name is [4-[4-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[4-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 101460975 |
| Molecular Formula | C36H39NO3 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | [4-[4-[[(1S)-1-phenylethyl]iminomethyl]phenyl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(/C=N/[C@@H](C)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H39NO3/c1-3-4-5-6-7-11-26-39-34-22-20-33(21-23-34)36(38)40-35-24-18-32(19-25-35)31-16-14-29(15-17-31)27-37-28(2)30-12-9-8-10-13-30/h8-10,12-25,27-28H,3-7,11,26H2,1-2H3/b37-27+/t28-/m0/s1 |
| InChIKey | QAZWIUOWZANVQS-RMTXRYRPSA-N |
| XLogP | 9.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|