C20H16F5NO5 — CID 101461044
(2,3,4,5,6-pentafluorophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylpropanoate (PubChem CID 101461044) has the molecular formula C20H16F5NO5 and a molecular weight of 445.34 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylpropanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 101461044 |
| Molecular Formula | C20H16F5NO5 |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16F5NO5/c1-20(2,3)31-19(29)26-15(16(27)9-7-5-4-6-8-9)18(28)30-17-13(24)11(22)10(21)12(23)14(17)25/h4-8,15H,1-3H3,(H,26,29)/t15-/m0/s1 |
| InChIKey | CZHGBLKAUYTISO-HNNXBMFYSA-N |
| XLogP | 4.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|