C17H18F5NO6 — CID 11133712
1-O-methyl 4-O-(2,3,4,5,6-pentafluorophenyl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 11133712) has the molecular formula C17H18F5NO6 and a molecular weight of 427.32 g/mol. Its IUPAC name is 1-O-methyl 4-O-(2,3,4,5,6-pentafluorophenyl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 1-O-methyl 4-O-(2,3,4,5,6-pentafluorophenyl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 11133712 |
| Molecular Formula | C17H18F5NO6 |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-O-methyl 4-O-(2,3,4,5,6-pentafluorophenyl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | COC(=O)[C@H](NC(=O)OC(C)(C)C)[C@H](C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H18F5NO6/c1-6(12(15(25)27-5)23-16(26)29-17(2,3)4)14(24)28-13-10(21)8(19)7(18)9(20)11(13)22/h6,12H,1-5H3,(H,23,26)/t6-,12+/m0/s1 |
| InChIKey | JVBTVYFWYUASMG-PWCHPLFNSA-N |
| XLogP | 2.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|