C23H27F4NO4 — CID 166899505
(2,3,4,6-tetrafluoro-5-prop-2-enylphenyl) (2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 166899505) has the molecular formula C23H27F4NO4 and a molecular weight of 457.46 g/mol. Its IUPAC name is (2,3,4,6-tetrafluoro-5-prop-2-enylphenyl) (2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (2,3,4,6-tetrafluoro-5-prop-2-enylphenyl) (2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 166899505 |
| Molecular Formula | C23H27F4NO4 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2,3,4,6-tetrafluoro-5-prop-2-enylphenyl) (2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CCc1c(F)c(F)c(F)c(OC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C2CC2)C2CC2)c1F |
| InChI | InChI=1S/C23H27F4NO4/c1-5-6-13-15(24)17(26)18(27)20(16(13)25)31-21(29)19(28-22(30)32-23(2,3)4)14(11-7-8-11)12-9-10-12/h5,11-12,14,19H,1,6-10H2,2-4H3,(H,28,30)/t19-/m0/s1 |
| InChIKey | QIHGRZWTBGBWJE-IBGZPJMESA-N |
| XLogP | 5.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|