C22H17NOS — CID 101462238
1-(2,2-diphenylethenyl)-5-methyl-2,1-benzothiazol-3-one (PubChem CID 101462238) has the molecular formula C22H17NOS and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(2,2-diphenylethenyl)-5-methyl-2,1-benzothiazol-3-one.
| Compound Name | 1-(2,2-diphenylethenyl)-5-methyl-2,1-benzothiazol-3-one |
|---|---|
| PubChem CID | 101462238 |
| Molecular Formula | C22H17NOS |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-(2,2-diphenylethenyl)-5-methyl-2,1-benzothiazol-3-one |
| SMILES | Cc1ccc2c(c1)c(=O)sn2C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17NOS/c1-16-12-13-21-19(14-16)22(24)25-23(21)15-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | CUIZRQPRANWQGZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'} |
|---|