C14H11NOS — CID 22416232
5-methyl-2-phenyl-1,2-benzothiazol-3-one (PubChem CID 22416232) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is 5-methyl-2-phenyl-1,2-benzothiazol-3-one.
| Compound Name | 5-methyl-2-phenyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 22416232 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 5-methyl-2-phenyl-1,2-benzothiazol-3-one |
| SMILES | Cc1ccc2sn(-c3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C14H11NOS/c1-10-7-8-13-12(9-10)14(16)15(17-13)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | OTSWDYIGEFXSDT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |