C12H8N2+2 — CID 101463036
1,10-phenanthroline-1,10-diium (PubChem CID 101463036) has the molecular formula C12H8N2+2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1,10-phenanthroline-1,10-diium.
| Compound Name | 1,10-phenanthroline-1,10-diium |
|---|---|
| PubChem CID | 101463036 |
| Molecular Formula | C12H8N2+2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1,10-phenanthroline-1,10-diium |
| SMILES | C1=Cc2ccc3c(c2=[N+]=C1)=[N+]=CC=C3 |
| InChI | InChI=1S/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H/q+2 |
| InChIKey | WMDVKFHMFWODLC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|