C29H23NO3 — CID 101463833
benzyl 2-[(S)-benzamido(naphthalen-2-yl)methyl]buta-2,3-dienoate (PubChem CID 101463833) has the molecular formula C29H23NO3 and a molecular weight of 433.51 g/mol. Its IUPAC name is benzyl 2-[(S)-benzamido(naphthalen-2-yl)methyl]buta-2,3-dienoate.
| Compound Name | benzyl 2-[(S)-benzamido(naphthalen-2-yl)methyl]buta-2,3-dienoate |
|---|---|
| PubChem CID | 101463833 |
| Molecular Formula | C29H23NO3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | benzyl 2-[(S)-benzamido(naphthalen-2-yl)methyl]buta-2,3-dienoate |
| SMILES | C=C=C(C(=O)OCc1ccccc1)[C@@H](NC(=O)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H23NO3/c1-2-26(29(32)33-20-21-11-5-3-6-12-21)27(30-28(31)23-14-7-4-8-15-23)25-18-17-22-13-9-10-16-24(22)19-25/h3-19,27H,1,20H2,(H,30,31)/t27-/m0/s1 |
| InChIKey | WOEICXWXYBHHEP-MHZLTWQESA-N |
| XLogP | 5.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|