C21H21NO4 — CID 74832949
benzyl 2-[(ethoxycarbonylamino)-phenylmethyl]buta-2,3-dienoate (PubChem CID 74832949) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is benzyl 2-[(ethoxycarbonylamino)-phenylmethyl]buta-2,3-dienoate.
| Compound Name | benzyl 2-[(ethoxycarbonylamino)-phenylmethyl]buta-2,3-dienoate |
|---|---|
| PubChem CID | 74832949 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | benzyl 2-[(ethoxycarbonylamino)-phenylmethyl]buta-2,3-dienoate |
| SMILES | C=C=C(C(=O)OCc1ccccc1)C(NC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C21H21NO4/c1-3-18(20(23)26-15-16-11-7-5-8-12-16)19(22-21(24)25-4-2)17-13-9-6-10-14-17/h5-14,19H,1,4,15H2,2H3,(H,22,24) |
| InChIKey | PIFPTYCAYKJNMS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|