C16H15NO — CID 101464312
3-(4-ethenylphenyl)-2,4-dihydro-1,3-benzoxazine (PubChem CID 101464312) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(4-ethenylphenyl)-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-(4-ethenylphenyl)-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 101464312 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-(4-ethenylphenyl)-2,4-dihydro-1,3-benzoxazine |
| SMILES | C=Cc1ccc(N2COc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H15NO/c1-2-13-7-9-15(10-8-13)17-11-14-5-3-4-6-16(14)18-12-17/h2-10H,1,11-12H2 |
| InChIKey | DHUFLOAPAZBHGM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|