C17H21NO6 — CID 101464485
2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 101464485) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 101464485 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-phenylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@H](c2ccccc2)[C@H](C(=O)OC)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C17H21NO6/c1-4-24-17(21)14-12(16(20)23-3)11(15(19)22-2)13(18-14)10-8-6-5-7-9-10/h5-9,11-14,18H,4H2,1-3H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | PLFGGEUMFOHTJU-XJFOESAGSA-N |
| XLogP | 0.84 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|