C18H22FNO5 — CID 135005936
diethyl (3R,4R,5S)-5-(2-fluorophenyl)-4-formyl-3-methylpyrrolidine-2,2-dicarboxylate (PubChem CID 135005936) has the molecular formula C18H22FNO5 and a molecular weight of 351.37 g/mol. Its IUPAC name is diethyl (3R,4R,5S)-5-(2-fluorophenyl)-4-formyl-3-methylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4R,5S)-5-(2-fluorophenyl)-4-formyl-3-methylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135005936 |
| Molecular Formula | C18H22FNO5 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | diethyl (3R,4R,5S)-5-(2-fluorophenyl)-4-formyl-3-methylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2ccccc2F)[C@H](C=O)[C@H]1C |
| InChI | InChI=1S/C18H22FNO5/c1-4-24-16(22)18(17(23)25-5-2)11(3)13(10-21)15(20-18)12-8-6-7-9-14(12)19/h6-11,13,15,20H,4-5H2,1-3H3/t11-,13-,15-/m1/s1 |
| InChIKey | UCLHLMAKQJQONL-UXIGCNINSA-N |
| XLogP | 1.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|