C14H17NO2 — CID 101464501
(7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 101464501) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 101464501 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | O=C1CC[C@H]2[C@H](O)[C@@H](c3ccccc3)CCN12 |
| InChI | InChI=1S/C14H17NO2/c16-13-7-6-12-14(17)11(8-9-15(12)13)10-4-2-1-3-5-10/h1-5,11-12,14,17H,6-9H2/t11-,12+,14-/m1/s1 |
| InChIKey | LOIRDBWJEBBJLX-MBNYWOFBSA-N |
| XLogP | 1.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |