C30H40N6 — CID 101464856
N,N'-bis(2,6-dipyrrolidin-1-ylphenyl)ethane-1,2-diimine (PubChem CID 101464856) has the molecular formula C30H40N6 and a molecular weight of 484.69 g/mol. Its IUPAC name is N,N'-bis(2,6-dipyrrolidin-1-ylphenyl)ethane-1,2-diimine.
| Compound Name | N,N'-bis(2,6-dipyrrolidin-1-ylphenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 101464856 |
| Molecular Formula | C30H40N6 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | N,N'-bis(2,6-dipyrrolidin-1-ylphenyl)ethane-1,2-diimine |
| SMILES | C(/C=N/c1c(N2CCCC2)cccc1N1CCCC1)=N\c1c(N2CCCC2)cccc1N1CCCC1 |
| InChI | InChI=1S/C30H40N6/c1-2-18-33(17-1)25-11-9-12-26(34-19-3-4-20-34)29(25)31-15-16-32-30-27(35-21-5-6-22-35)13-10-14-28(30)36-23-7-8-24-36/h9-16H,1-8,17-24H2/b31-15+,32-16+ |
| InChIKey | WJZHWTGSTHKJJV-IHXWQEJPSA-N |
| XLogP | 6.19 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|