C15H15BrO3 — CID 101465212
(1S,5S,6R,7R)-7-(4-bromophenyl)-5-hydroxy-8-oxobicyclo[3.2.1]octane-6-carbaldehyde (PubChem CID 101465212) has the molecular formula C15H15BrO3 and a molecular weight of 323.19 g/mol. Its IUPAC name is (1S,5S,6R,7R)-7-(4-bromophenyl)-5-hydroxy-8-oxobicyclo[3.2.1]octane-6-carbaldehyde.
| Compound Name | (1S,5S,6R,7R)-7-(4-bromophenyl)-5-hydroxy-8-oxobicyclo[3.2.1]octane-6-carbaldehyde |
|---|---|
| PubChem CID | 101465212 |
| Molecular Formula | C15H15BrO3 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (1S,5S,6R,7R)-7-(4-bromophenyl)-5-hydroxy-8-oxobicyclo[3.2.1]octane-6-carbaldehyde |
| SMILES | O=C[C@@H]1[C@@H](c2ccc(Br)cc2)[C@@H]2CCC[C@@]1(O)C2=O |
| InChI | InChI=1S/C15H15BrO3/c16-10-5-3-9(4-6-10)13-11-2-1-7-15(19,14(11)18)12(13)8-17/h3-6,8,11-13,19H,1-2,7H2/t11-,12+,13-,15-/m0/s1 |
| InChIKey | YVDJYHAAMPMYDM-XFMPKHEZSA-N |
| XLogP | 2.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|