C15H16O3 — CID 134859797
(6R,7S)-1-hydroxy-8-oxo-7-phenylbicyclo[3.2.1]octane-6-carbaldehyde (PubChem CID 134859797) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (6R,7S)-1-hydroxy-8-oxo-7-phenylbicyclo[3.2.1]octane-6-carbaldehyde.
| Compound Name | (6R,7S)-1-hydroxy-8-oxo-7-phenylbicyclo[3.2.1]octane-6-carbaldehyde |
|---|---|
| PubChem CID | 134859797 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (6R,7S)-1-hydroxy-8-oxo-7-phenylbicyclo[3.2.1]octane-6-carbaldehyde |
| SMILES | O=C[C@H]1C2CCCC(O)(C2=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16O3/c16-9-12-11-7-4-8-15(18,14(11)17)13(12)10-5-2-1-3-6-10/h1-3,5-6,9,11-13,18H,4,7-8H2/t11?,12-,13+,15?/m0/s1 |
| InChIKey | XXZZBKZEWCAJKG-SBEAFCBVSA-N |
| XLogP | 1.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|