C18H22O3 — CID 10803134
(2R,3R,3aS,7aS)-2-hydroxy-3a,7,7-trimethyl-3-phenyl-3,4,6,7a-tetrahydro-2H-indene-1,5-dione (PubChem CID 10803134) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,3R,3aS,7aS)-2-hydroxy-3a,7,7-trimethyl-3-phenyl-3,4,6,7a-tetrahydro-2H-indene-1,5-dione.
| Compound Name | (2R,3R,3aS,7aS)-2-hydroxy-3a,7,7-trimethyl-3-phenyl-3,4,6,7a-tetrahydro-2H-indene-1,5-dione |
|---|---|
| PubChem CID | 10803134 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2R,3R,3aS,7aS)-2-hydroxy-3a,7,7-trimethyl-3-phenyl-3,4,6,7a-tetrahydro-2H-indene-1,5-dione |
| SMILES | CC1(C)CC(=O)C[C@@]2(C)[C@H](c3ccccc3)[C@@H](O)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H22O3/c1-17(2)9-12(19)10-18(3)13(11-7-5-4-6-8-11)14(20)15(21)16(17)18/h4-8,13-14,16,20H,9-10H2,1-3H3/t13-,14-,16+,18+/m1/s1 |
| InChIKey | DDAIGNVKZXPFNQ-DEICHXMPSA-N |
| XLogP | 2.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |