C18H22O2 — CID 10539988
(1S,3aR,7aS)-1-hydroxy-3a,7,7-trimethyl-3-phenyl-1,4,6,7a-tetrahydroinden-5-one (PubChem CID 10539988) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,3aR,7aS)-1-hydroxy-3a,7,7-trimethyl-3-phenyl-1,4,6,7a-tetrahydroinden-5-one.
| Compound Name | (1S,3aR,7aS)-1-hydroxy-3a,7,7-trimethyl-3-phenyl-1,4,6,7a-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 10539988 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S,3aR,7aS)-1-hydroxy-3a,7,7-trimethyl-3-phenyl-1,4,6,7a-tetrahydroinden-5-one |
| SMILES | CC1(C)CC(=O)C[C@@]2(C)C(c3ccccc3)=C[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C18H22O2/c1-17(2)10-13(19)11-18(3)14(9-15(20)16(17)18)12-7-5-4-6-8-12/h4-9,15-16,20H,10-11H2,1-3H3/t15-,16-,18-/m0/s1 |
| InChIKey | KVRFCXSMBIMVLQ-BQFCYCMXSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |