C16H20O2 — CID 11851208
(3S,3aS,7aS)-7a-hydroxy-3a-methyl-3-phenyl-1,2,3,5,6,7-hexahydroinden-4-one (PubChem CID 11851208) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3S,3aS,7aS)-7a-hydroxy-3a-methyl-3-phenyl-1,2,3,5,6,7-hexahydroinden-4-one.
| Compound Name | (3S,3aS,7aS)-7a-hydroxy-3a-methyl-3-phenyl-1,2,3,5,6,7-hexahydroinden-4-one |
|---|---|
| PubChem CID | 11851208 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3S,3aS,7aS)-7a-hydroxy-3a-methyl-3-phenyl-1,2,3,5,6,7-hexahydroinden-4-one |
| SMILES | C[C@@]12C(=O)CCC[C@]1(O)CC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H20O2/c1-15-13(12-6-3-2-4-7-12)9-11-16(15,18)10-5-8-14(15)17/h2-4,6-7,13,18H,5,8-11H2,1H3/t13-,15+,16-/m0/s1 |
| InChIKey | YANQOCFGJGIQSW-IMJJTQAJSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |