C20H22O2 — CID 14929091
1-[(1S,2R,4S,5R)-2-hydroxy-2-methyl-4,5-diphenylcyclopentyl]ethanone (PubChem CID 14929091) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[(1S,2R,4S,5R)-2-hydroxy-2-methyl-4,5-diphenylcyclopentyl]ethanone.
| Compound Name | 1-[(1S,2R,4S,5R)-2-hydroxy-2-methyl-4,5-diphenylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 14929091 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-[(1S,2R,4S,5R)-2-hydroxy-2-methyl-4,5-diphenylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@H]1[C@H](c2ccccc2)[C@@H](c2ccccc2)C[C@@]1(C)O |
| InChI | InChI=1S/C20H22O2/c1-14(21)19-18(16-11-7-4-8-12-16)17(13-20(19,2)22)15-9-5-3-6-10-15/h3-12,17-19,22H,13H2,1-2H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | ZGXJBXIHEYSWNO-YSTOQKLRSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |