C19H20O2 — CID 12981734
[(1S,2R,5R)-2-hydroxy-2-methyl-5-phenylcyclopentyl]-phenylmethanone (PubChem CID 12981734) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [(1S,2R,5R)-2-hydroxy-2-methyl-5-phenylcyclopentyl]-phenylmethanone.
| Compound Name | [(1S,2R,5R)-2-hydroxy-2-methyl-5-phenylcyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 12981734 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(1S,2R,5R)-2-hydroxy-2-methyl-5-phenylcyclopentyl]-phenylmethanone |
| SMILES | C[C@@]1(O)CC[C@@H](c2ccccc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c1-19(21)13-12-16(14-8-4-2-5-9-14)17(19)18(20)15-10-6-3-7-11-15/h2-11,16-17,21H,12-13H2,1H3/t16-,17+,19+/m0/s1 |
| InChIKey | VODNDZUPNQNTKG-YQVWRLOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |