C16H19FO2 — CID 134954057
(2R)-2-[(R)-cyclohexyl(hydroxy)methyl]-2-fluoro-3H-inden-1-one (PubChem CID 134954057) has the molecular formula C16H19FO2 and a molecular weight of 262.32 g/mol. Its IUPAC name is (2R)-2-[(R)-cyclohexyl(hydroxy)methyl]-2-fluoro-3H-inden-1-one.
| Compound Name | (2R)-2-[(R)-cyclohexyl(hydroxy)methyl]-2-fluoro-3H-inden-1-one |
|---|---|
| PubChem CID | 134954057 |
| Molecular Formula | C16H19FO2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2R)-2-[(R)-cyclohexyl(hydroxy)methyl]-2-fluoro-3H-inden-1-one |
| SMILES | O=C1c2ccccc2C[C@@]1(F)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C16H19FO2/c17-16(14(18)11-6-2-1-3-7-11)10-12-8-4-5-9-13(12)15(16)19/h4-5,8-9,11,14,18H,1-3,6-7,10H2/t14-,16-/m1/s1 |
| InChIKey | GYLKMPCSXIYINK-GDBMZVCRSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |