C17H16F2O2 — CID 164671793
2,2-difluoro-3-hydroxy-1,5-diphenylpentan-1-one (PubChem CID 164671793) has the molecular formula C17H16F2O2 and a molecular weight of 290.31 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-1,5-diphenylpentan-1-one.
| Compound Name | 2,2-difluoro-3-hydroxy-1,5-diphenylpentan-1-one |
|---|---|
| PubChem CID | 164671793 |
| Molecular Formula | C17H16F2O2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-1,5-diphenylpentan-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H16F2O2/c18-17(19,16(21)14-9-5-2-6-10-14)15(20)12-11-13-7-3-1-4-8-13/h1-10,15,20H,11-12H2 |
| InChIKey | XZASHCSJWUCJHP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |