C20H36Si — CID 101466434
2-[(1S,7R)-8-methyl-8-bicyclo[5.1.0]octanyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 101466434) has the molecular formula C20H36Si and a molecular weight of 304.59 g/mol. Its IUPAC name is 2-[(1S,7R)-8-methyl-8-bicyclo[5.1.0]octanyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[(1S,7R)-8-methyl-8-bicyclo[5.1.0]octanyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101466434 |
| Molecular Formula | C20H36Si |
| Molecular Weight | 304.59 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 2-[(1S,7R)-8-methyl-8-bicyclo[5.1.0]octanyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC1(C)[C@@H]2CCCCC[C@@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36Si/c1-15(2)21(16(3)4,17(5)6)14-13-20(7)18-11-9-8-10-12-19(18)20/h15-19H,8-12H2,1-7H3/t18-,19+,20? |
| InChIKey | CIKYALOBBSVOPF-YOFSQIOKSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|