C20H25O3PS3 — CID 101466632
2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]ethylphosphonic acid (PubChem CID 101466632) has the molecular formula C20H25O3PS3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]ethylphosphonic acid.
| Compound Name | 2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 101466632 |
| Molecular Formula | C20H25O3PS3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]ethylphosphonic acid |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(CCP(=O)(O)O)s3)s2)s1 |
| InChI | InChI=1S/C20H25O3PS3/c1-2-3-4-5-6-15-7-9-17(25-15)19-11-12-20(27-19)18-10-8-16(26-18)13-14-24(21,22)23/h7-12H,2-6,13-14H2,1H3,(H2,21,22,23) |
| InChIKey | ZMACHCDECUGKRQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|