C20H24BrO3PS3 — CID 135079642
2-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-5-(4-diethoxyphosphorylbutyl)thiophene (PubChem CID 135079642) has the molecular formula C20H24BrO3PS3 and a molecular weight of 519.49 g/mol. Its IUPAC name is 2-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-5-(4-diethoxyphosphorylbutyl)thiophene.
| Compound Name | 2-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-5-(4-diethoxyphosphorylbutyl)thiophene |
|---|---|
| PubChem CID | 135079642 |
| Molecular Formula | C20H24BrO3PS3 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 2-[5-(5-bromothiophen-2-yl)thiophen-2-yl]-5-(4-diethoxyphosphorylbutyl)thiophene |
| SMILES | CCOP(=O)(CCCCc1ccc(-c2ccc(-c3ccc(Br)s3)s2)s1)OCC |
| InChI | InChI=1S/C20H24BrO3PS3/c1-3-23-25(22,24-4-2)14-6-5-7-15-8-9-16(26-15)17-10-11-18(27-17)19-12-13-20(21)28-19/h8-13H,3-7,14H2,1-2H3 |
| InChIKey | OMMIHHJWHXKIDY-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|