C22H30O6P2S3 — CID 59155882
3,4-bis(diethoxyphosphoryl)-2,5-bis(5-methylthiophen-2-yl)thiophene (PubChem CID 59155882) has the molecular formula C22H30O6P2S3 and a molecular weight of 548.63 g/mol. Its IUPAC name is 3,4-bis(diethoxyphosphoryl)-2,5-bis(5-methylthiophen-2-yl)thiophene.
| Compound Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis(5-methylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 59155882 |
| Molecular Formula | C22H30O6P2S3 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis(5-methylthiophen-2-yl)thiophene |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccc(C)s2)sc(-c2ccc(C)s2)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H30O6P2S3/c1-7-25-29(23,26-8-2)19-20(30(24,27-9-3)28-10-4)22(18-14-12-16(6)32-18)33-21(19)17-13-11-15(5)31-17/h11-14H,7-10H2,1-6H3 |
| InChIKey | MNOZSNBMJIKFDR-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|