C16H17O3PS3 — CID 58782883
4-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butylphosphonic acid (PubChem CID 58782883) has the molecular formula C16H17O3PS3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butylphosphonic acid.
| Compound Name | 4-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butylphosphonic acid |
|---|---|
| PubChem CID | 58782883 |
| Molecular Formula | C16H17O3PS3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 4-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]butylphosphonic acid |
| SMILES | O=P(O)(O)CCCCc1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C16H17O3PS3/c17-20(18,19)10-2-1-4-12-6-7-15(22-12)16-9-8-14(23-16)13-5-3-11-21-13/h3,5-9,11H,1-2,4,10H2,(H2,17,18,19) |
| InChIKey | DSFIUHPCLZOKOJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|