C20H26O4P2S3 — CID 59155808
3-diethoxyphosphoryl-4-dimethylphosphoryl-2,5-bis(5-methylthiophen-2-yl)thiophene (PubChem CID 59155808) has the molecular formula C20H26O4P2S3 and a molecular weight of 488.57 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-4-dimethylphosphoryl-2,5-bis(5-methylthiophen-2-yl)thiophene.
| Compound Name | 3-diethoxyphosphoryl-4-dimethylphosphoryl-2,5-bis(5-methylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 59155808 |
| Molecular Formula | C20H26O4P2S3 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 3-diethoxyphosphoryl-4-dimethylphosphoryl-2,5-bis(5-methylthiophen-2-yl)thiophene |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccc(C)s2)sc(-c2ccc(C)s2)c1P(C)(C)=O |
| InChI | InChI=1S/C20H26O4P2S3/c1-7-23-26(22,24-8-2)18-17(25(5,6)21)19(15-11-9-13(3)27-15)29-20(18)16-12-10-14(4)28-16/h9-12H,7-8H2,1-6H3 |
| InChIKey | GXCQYOJIXHJBKI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|