C36H34O6P2S7 — CID 59155819
3,4-bis(diethoxyphosphoryl)-2,5-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophene (PubChem CID 59155819) has the molecular formula C36H34O6P2S7 and a molecular weight of 849.08 g/mol. Its IUPAC name is 3,4-bis(diethoxyphosphoryl)-2,5-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophene.
| Compound Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 59155819 |
| Molecular Formula | C36H34O6P2S7 |
| Molecular Weight | 849.08 g/mol |
| Exact Mass | 847.99 |
| IUPAC Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophene |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccc(-c3ccc(-c4cccs4)s3)s2)sc(-c2ccc(-c3ccc(-c4cccs4)s3)s2)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C36H34O6P2S7/c1-5-39-43(37,40-6-2)33-34(44(38,41-7-3)42-8-4)36(32-20-18-30(50-32)28-16-14-26(48-28)24-12-10-22-46-24)51-35(33)31-19-17-29(49-31)27-15-13-25(47-27)23-11-9-21-45-23/h9-22H,5-8H2,1-4H3 |
| InChIKey | LRWDPDVLRGFESR-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.08 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|