C32H32O6P2S6 — CID 22634626
4-[2-(4-phosphonobutyl)-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]butylphosphonic acid (PubChem CID 22634626) has the molecular formula C32H32O6P2S6 and a molecular weight of 766.95 g/mol. Its IUPAC name is 4-[2-(4-phosphonobutyl)-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]butylphosphonic acid.
| Compound Name | 4-[2-(4-phosphonobutyl)-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]butylphosphonic acid |
|---|---|
| PubChem CID | 22634626 |
| Molecular Formula | C32H32O6P2S6 |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.00 |
| IUPAC Name | 4-[2-(4-phosphonobutyl)-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophen-3-yl]butylphosphonic acid |
| SMILES | O=P(O)(O)CCCCc1sc(-c2sc(-c3cccs3)c(-c3cccs3)c2-c2cccs2)c(-c2cccs2)c1CCCCP(=O)(O)O |
| InChI | InChI=1S/C32H32O6P2S6/c33-39(34,35)15-3-1-9-21-22(10-2-4-16-40(36,37)38)45-31(27(21)23-11-5-17-41-23)32-29(25-13-7-19-43-25)28(24-12-6-18-42-24)30(46-32)26-14-8-20-44-26/h5-8,11-14,17-20H,1-4,9-10,15-16H2,(H2,33,34,35)(H2,36,37,38) |
| InChIKey | KQHWZGBGZDMQHQ-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|