About 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate
1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate (PubChem CID 101466737) has the molecular formula C7H13NO5
and a molecular weight of 191.18 g/mol. Its IUPAC name is 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate |
| PubChem CID | 101466737 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate |
| SMILES | O=C(NCCO)OC1COCOC1 |
| InChI | InChI=1S/C7H13NO5/c9-2-1-8-7(10)13-6-3-11-5-12-4-6/h6,9H,1-5H2,(H,8,10) |
| InChIKey | WSPOGSZNMOLWIY-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate?
The IUPAC name of 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate (CID 101466737) is 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate?
The canonical SMILES for 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate is O=C(NCCO)OC1COCOC1.
What is the InChIKey of 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate?
The InChIKey is WSPOGSZNMOLWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO5/c9-2-1-8-7(10)13-6-3-11-5-12-4-6/h6,9H,1-5H2,(H,8,10).
What are the key properties of 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate?
1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate has a molecular weight of 191.18 g/mol, XLogP of -0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxan-5-yl N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 101466737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).