About 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one
3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one (PubChem CID 101467130) has the molecular formula C23H27N3O3
and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one |
| PubChem CID | 101467130 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1C[C@H](O)C[C@H]1NCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H27N3O3/c27-18(14-26-16-25-20-10-5-4-9-19(20)23(26)28)13-21-22(11-6-12-24-21)29-15-17-7-2-1-3-8-17/h1-5,7-10,16,18,21-22,24,27H,6,11-15H2/t18-,21-,22+/m1/s1 |
| InChIKey | SQUVKXZYQBWWTK-QIJUGHKUSA-N |
| XLogP | 2.48 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one?
The IUPAC name of 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one (CID 101467130) is 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one.
What is the SMILES notation for 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one?
The canonical SMILES for 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one is O=c1c2ccccc2ncn1C[C@H](O)C[C@H]1NCCC[C@@H]1OCc1ccccc1.
What is the InChIKey of 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one?
The InChIKey is SQUVKXZYQBWWTK-QIJUGHKUSA-N. The full InChI is InChI=1S/C23H27N3O3/c27-18(14-26-16-25-20-10-5-4-9-19(20)23(26)28)13-21-22(11-6-12-24-21)29-15-17-7-2-1-3-8-17/h1-5,7-10,16,18,21-22,24,27H,6,11-15H2/t18-,21-,22+/m1/s1.
What are the key properties of 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one?
3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one has a molecular weight of 393.49 g/mol, XLogP of 2.48, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-2-hydroxy-3-[(2R,3S)-3-phenylmethoxypiperidin-2-yl]propyl]quinazolin-4-one is sourced from PubChem (CID 101467130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).