C27H18N10 — CID 1014695
4,6-bis(benzotriazol-1-yl)-N,N-diphenyl-1,3,5-triazin-2-amine (PubChem CID 1014695) has the molecular formula C27H18N10 and a molecular weight of 482.51 g/mol. Its IUPAC name is 4,6-bis(benzotriazol-1-yl)-N,N-diphenyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(benzotriazol-1-yl)-N,N-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1014695 |
| Molecular Formula | C27H18N10 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4,6-bis(benzotriazol-1-yl)-N,N-diphenyl-1,3,5-triazin-2-amine |
| SMILES | c1ccc(N(c2ccccc2)c2nc(-n3nnc4ccccc43)nc(-n3nnc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C27H18N10/c1-3-11-19(12-4-1)35(20-13-5-2-6-14-20)25-28-26(36-23-17-9-7-15-21(23)31-33-36)30-27(29-25)37-24-18-10-8-16-22(24)32-34-37/h1-18H |
| InChIKey | JWTCVILNPNMFMK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 103.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |