C10H9N7O — CID 80854027
4-(benzotriazol-1-yl)-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 80854027) has the molecular formula C10H9N7O and a molecular weight of 243.23 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(benzotriazol-1-yl)-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80854027 |
| Molecular Formula | C10H9N7O |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-(benzotriazol-1-yl)-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(-n2nnc3ccccc32)n1 |
| InChI | InChI=1S/C10H9N7O/c1-18-10-13-8(11)12-9(14-10)17-7-5-3-2-4-6(7)15-16-17/h2-5H,1H3,(H2,11,12,13,14) |
| InChIKey | DVOZPBHPWSUUNA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |