C22H18N8O2 — CID 3769111
[5-(benzotriazol-1-yl)-2-(4-methoxyphenyl)-1,2,4-triazol-3-yl]-(4-methoxyphenyl)diazene (PubChem CID 3769111) has the molecular formula C22H18N8O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is [5-(benzotriazol-1-yl)-2-(4-methoxyphenyl)-1,2,4-triazol-3-yl]-(4-methoxyphenyl)diazene.
| Compound Name | [5-(benzotriazol-1-yl)-2-(4-methoxyphenyl)-1,2,4-triazol-3-yl]-(4-methoxyphenyl)diazene |
|---|---|
| PubChem CID | 3769111 |
| Molecular Formula | C22H18N8O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [5-(benzotriazol-1-yl)-2-(4-methoxyphenyl)-1,2,4-triazol-3-yl]-(4-methoxyphenyl)diazene |
| SMILES | COc1ccc(/N=N/c2nc(-n3nnc4ccccc43)nn2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H18N8O2/c1-31-17-11-7-15(8-12-17)24-26-21-23-22(30-20-6-4-3-5-19(20)25-28-30)27-29(21)16-9-13-18(32-2)14-10-16/h3-14H,1-2H3/b26-24+ |
| InChIKey | XQDWAWPQJONVPB-SHHOIMCASA-N |
| XLogP | 4.43 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|