C26H32O12 — CID 101470066
(3S,4S)-4-[bis(4-hydroxy-3-methoxyphenyl)methyl]-3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxolan-2-one (PubChem CID 101470066) has the molecular formula C26H32O12 and a molecular weight of 536.53 g/mol. Its IUPAC name is (3S,4S)-4-[bis(4-hydroxy-3-methoxyphenyl)methyl]-3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxolan-2-one.
| Compound Name | (3S,4S)-4-[bis(4-hydroxy-3-methoxyphenyl)methyl]-3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 101470066 |
| Molecular Formula | C26H32O12 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | (3S,4S)-4-[bis(4-hydroxy-3-methoxyphenyl)methyl]-3-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxolan-2-one |
| SMILES | COc1cc(C(c2ccc(O)c(OC)c2)[C@@H]2COC(=O)[C@@H]2CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C26H32O12/c1-34-18-7-12(3-5-16(18)28)21(13-4-6-17(29)19(8-13)35-2)14-10-36-25(33)15(14)11-37-26-24(32)23(31)22(30)20(9-27)38-26/h3-8,14-15,20-24,26-32H,9-11H2,1-2H3/t14-,15-,20-,22-,23+,24-,26-/m1/s1 |
| InChIKey | SMIMEBJMBCDXJI-KKQRDYOTSA-N |
| XLogP | -0.15 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |