C20H22O8 — CID 163025689
(3S,4R)-3,4-bis[(S)-hydroxy-(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one (PubChem CID 163025689) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is (3S,4R)-3,4-bis[(S)-hydroxy-(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one.
| Compound Name | (3S,4R)-3,4-bis[(S)-hydroxy-(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 163025689 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (3S,4R)-3,4-bis[(S)-hydroxy-(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| SMILES | COc1cc([C@@H](O)[C@H]2COC(=O)[C@@H]2[C@H](O)c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H22O8/c1-26-15-7-10(3-5-13(15)21)18(23)12-9-28-20(25)17(12)19(24)11-4-6-14(22)16(8-11)27-2/h3-8,12,17-19,21-24H,9H2,1-2H3/t12-,17-,18+,19+/m0/s1 |
| InChIKey | KEFXTBAPNKOJAA-MDVLYUJXSA-N |
| XLogP | 1.67 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |