C10H7F3O — CID 101470069
(2S)-1,1,1-trifluoro-4-phenylbut-3-yn-2-ol (PubChem CID 101470069) has the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-4-phenylbut-3-yn-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-4-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 101470069 |
| Molecular Formula | C10H7F3O |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (2S)-1,1,1-trifluoro-4-phenylbut-3-yn-2-ol |
| SMILES | O[C@@H](C#Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H7F3O/c11-10(12,13)9(14)7-6-8-4-2-1-3-5-8/h1-5,9,14H/t9-/m0/s1 |
| InChIKey | PISHZENUSKYJSY-VIFPVBQESA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|