C12H26O3Si — CID 101470587
(1R,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 101470587) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is (1R,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 101470587 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (1R,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](CO)[C@H](O)C1 |
| InChI | InChI=1S/C12H26O3Si/c1-12(2,3)16(4,5)15-10-6-9(8-13)11(14)7-10/h9-11,13-14H,6-8H2,1-5H3/t9-,10+,11+/m0/s1 |
| InChIKey | OHNBJXHCVWEPQX-HBNTYKKESA-N |
| XLogP | 2.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|