C12H25FO3Si — CID 156903573
(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 156903573) has the molecular formula C12H25FO3Si and a molecular weight of 264.41 g/mol. Its IUPAC name is (1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 156903573 |
| Molecular Formula | C12H25FO3Si |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H](O)[C@]1(F)CO |
| InChI | InChI=1S/C12H25FO3Si/c1-11(2,3)17(4,5)16-10-7-6-9(15)12(10,13)8-14/h9-10,14-15H,6-8H2,1-5H3/t9-,10-,12+/m0/s1 |
| InChIKey | HQRQWICAMJRSQC-JBLDHEPKSA-N |
| XLogP | 2.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|