C15H9N9S3 — CID 101470685
2,4,6-tris(pyrimidin-2-ylsulfanyl)-1,3,5-triazine (PubChem CID 101470685) has the molecular formula C15H9N9S3 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2,4,6-tris(pyrimidin-2-ylsulfanyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(pyrimidin-2-ylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 101470685 |
| Molecular Formula | C15H9N9S3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2,4,6-tris(pyrimidin-2-ylsulfanyl)-1,3,5-triazine |
| SMILES | c1cnc(Sc2nc(Sc3ncccn3)nc(Sc3ncccn3)n2)nc1 |
| InChI | InChI=1S/C15H9N9S3/c1-4-16-10(17-5-1)25-13-22-14(26-11-18-6-2-7-19-11)24-15(23-13)27-12-20-8-3-9-21-12/h1-9H |
| InChIKey | NIBISFFQUPKYCV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |