About [(Z)-4,5-dicyanopent-4-enyl] acetate
[(Z)-4,5-dicyanopent-4-enyl] acetate (PubChem CID 101471670) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is [(Z)-4,5-dicyanopent-4-enyl] acetate.
Molecular Properties
| Compound Name | [(Z)-4,5-dicyanopent-4-enyl] acetate |
| PubChem CID | 101471670 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | [(Z)-4,5-dicyanopent-4-enyl] acetate |
| SMILES | CC(=O)OCCC/C(C#N)=C/C#N |
| InChI | InChI=1S/C9H10N2O2/c1-8(12)13-6-2-3-9(7-11)4-5-10/h4H,2-3,6H2,1H3/b9-4- |
| InChIKey | XULRJSSFHSGWRI-WTKPLQERSA-N |
| XLogP | 1.30 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4,5-dicyanopent-4-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4,5-dicyanopent-4-enyl] acetate?
The IUPAC name of [(Z)-4,5-dicyanopent-4-enyl] acetate (CID 101471670) is [(Z)-4,5-dicyanopent-4-enyl] acetate.
What is the SMILES notation for [(Z)-4,5-dicyanopent-4-enyl] acetate?
The canonical SMILES for [(Z)-4,5-dicyanopent-4-enyl] acetate is CC(=O)OCCC/C(C#N)=C/C#N.
What is the InChIKey of [(Z)-4,5-dicyanopent-4-enyl] acetate?
The InChIKey is XULRJSSFHSGWRI-WTKPLQERSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-8(12)13-6-2-3-9(7-11)4-5-10/h4H,2-3,6H2,1H3/b9-4-.
What are the key properties of [(Z)-4,5-dicyanopent-4-enyl] acetate?
[(Z)-4,5-dicyanopent-4-enyl] acetate has a molecular weight of 178.19 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4,5-dicyanopent-4-enyl] acetate is sourced from PubChem (CID 101471670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).